C11H20NNaO2 — CID 23668447
sodium (2S)-2-(2,2-dimethylpropylideneamino)-4-methylpentanoate (PubChem CID 23668447) has the molecular formula C11H20NNaO2 and a molecular weight of 221.28 g/mol. Its IUPAC name is sodium (2S)-2-(2,2-dimethylpropylideneamino)-4-methylpentanoate.
| Compound Name | sodium (2S)-2-(2,2-dimethylpropylideneamino)-4-methylpentanoate |
|---|---|
| PubChem CID | 23668447 |
| Molecular Formula | C11H20NNaO2 |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | sodium (2S)-2-(2,2-dimethylpropylideneamino)-4-methylpentanoate |
| SMILES | CC(C)C[C@H](/N=C/C(C)(C)C)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C11H21NO2.Na/c1-8(2)6-9(10(13)14)12-7-11(3,4)5;/h7-9H,6H2,1-5H3,(H,13,14);/q;+1/p-1/b12-7+;/t9-;/m0./s1 |
| InChIKey | PSIUKGIBODZHFR-UGQUMZJPSA-M |
| XLogP | -1.73 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|