C6H8NO2- — CID 91819834
(2S,4R)-4-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate (PubChem CID 91819834) has the molecular formula C6H8NO2- and a molecular weight of 126.13 g/mol. Its IUPAC name is (2S,4R)-4-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate.
| Compound Name | (2S,4R)-4-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 91819834 |
| Molecular Formula | C6H8NO2- |
| Molecular Weight | 126.13 g/mol |
| Exact Mass | 126.06 |
| IUPAC Name | (2S,4R)-4-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate |
| SMILES | C[C@H]1C=N[C@H](C(=O)[O-])C1 |
| InChI | InChI=1S/C6H9NO2/c1-4-2-5(6(8)9)7-3-4/h3-5H,2H2,1H3,(H,8,9)/p-1/t4-,5+/m1/s1 |
| InChIKey | GSYWFASSLUGNSS-UHNVWZDZSA-M |
| XLogP | -0.78 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.13 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |