C14H27LiO2Si — CID 134892553
lithium (2S,3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhex-5-yn-3-ol (PubChem CID 134892553) has the molecular formula C14H27LiO2Si and a molecular weight of 262.39 g/mol. Its IUPAC name is lithium (2S,3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhex-5-yn-3-ol.
| Compound Name | lithium (2S,3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhex-5-yn-3-ol |
|---|---|
| PubChem CID | 134892553 |
| Molecular Formula | C14H27LiO2Si |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | lithium (2S,3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhex-5-yn-3-ol |
| SMILES | [C-]#C[C@H](C)[C@H](O)[C@@H](C)CO[Si](C)(C)C(C)(C)C.[Li+] |
| InChI | InChI=1S/C14H27O2Si.Li/c1-9-11(2)13(15)12(3)10-16-17(7,8)14(4,5)6;/h11-13,15H,10H2,2-8H3;/q-1;+1/t11-,12-,13-;/m0./s1 |
| InChIKey | DWDSUTGWOWDIBQ-QKWXXBCPSA-N |
| XLogP | 0.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|