C8H16ClN2O3P — CID 134893452
3-[chloro(morpholin-4-yl)phosphoryl]-1,3-oxazinane (PubChem CID 134893452) has the molecular formula C8H16ClN2O3P and a molecular weight of 254.65 g/mol. Its IUPAC name is 3-[chloro(morpholin-4-yl)phosphoryl]-1,3-oxazinane.
| Compound Name | 3-[chloro(morpholin-4-yl)phosphoryl]-1,3-oxazinane |
|---|---|
| PubChem CID | 134893452 |
| Molecular Formula | C8H16ClN2O3P |
| Molecular Weight | 254.65 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 3-[chloro(morpholin-4-yl)phosphoryl]-1,3-oxazinane |
| SMILES | O=P(Cl)(N1CCOCC1)N1CCCOC1 |
| InChI | InChI=1S/C8H16ClN2O3P/c9-15(12,10-3-6-13-7-4-10)11-2-1-5-14-8-11/h1-8H2 |
| InChIKey | SWBSIPAXPFIIBW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.65 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|