C16H32N2O6 — CID 58981463
4,7,13,16,20,23-hexaoxa-1,10-diazabicyclo[8.8.6]tetracosane (PubChem CID 58981463) has the molecular formula C16H32N2O6 and a molecular weight of 348.44 g/mol. Its IUPAC name is 4,7,13,16,20,23-hexaoxa-1,10-diazabicyclo[8.8.6]tetracosane.
| Compound Name | 4,7,13,16,20,23-hexaoxa-1,10-diazabicyclo[8.8.6]tetracosane |
|---|---|
| PubChem CID | 58981463 |
| Molecular Formula | C16H32N2O6 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 4,7,13,16,20,23-hexaoxa-1,10-diazabicyclo[8.8.6]tetracosane |
| SMILES | C1COCCN2CCOCCOCCN(CCO1)COCCOC2 |
| InChI | InChI=1S/C16H32N2O6/c1-5-19-9-10-21-7-3-18-4-8-22-12-11-20-6-2-17(1)15-23-13-14-24-16-18/h1-16H2 |
| InChIKey | NUIWFGBJKQULEK-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 61.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |