C7H14N2O2 — CID 14967081
3,8-dioxa-1,6-diazabicyclo[4.4.1]undecane (PubChem CID 14967081) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 3,8-dioxa-1,6-diazabicyclo[4.4.1]undecane.
| Compound Name | 3,8-dioxa-1,6-diazabicyclo[4.4.1]undecane |
|---|---|
| PubChem CID | 14967081 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 3,8-dioxa-1,6-diazabicyclo[4.4.1]undecane |
| SMILES | C1CN2COCCN(CO1)C2 |
| InChI | InChI=1S/C7H14N2O2/c1-3-10-7-9-2-4-11-6-8(1)5-9/h1-7H2 |
| InChIKey | AZNFWBOWWNJHHG-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |