C8H12N2O2S4Zn — CID 21453977
zinc bis(1,3-oxazolidine-3-carbodithioate) (PubChem CID 21453977) has the molecular formula C8H12N2O2S4Zn and a molecular weight of 361.85 g/mol. Its IUPAC name is zinc bis(1,3-oxazolidine-3-carbodithioate).
| Compound Name | zinc bis(1,3-oxazolidine-3-carbodithioate) |
|---|---|
| PubChem CID | 21453977 |
| Molecular Formula | C8H12N2O2S4Zn |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 359.91 |
| IUPAC Name | zinc bis(1,3-oxazolidine-3-carbodithioate) |
| SMILES | S=C([S-])N1CCOC1.S=C([S-])N1CCOC1.[Zn+2] |
| InChI | InChI=1S/2C4H7NOS2.Zn/c2*7-4(8)5-1-2-6-3-5;/h2*1-3H2,(H,7,8);/q;;+2/p-2 |
| InChIKey | QXTFBRRNRHKAKA-UHFFFAOYSA-L |
| XLogP | 0.21 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|