C4H8N2OS — CID 57154446
1,3-oxazolidine-3-carbothioamide (PubChem CID 57154446) has the molecular formula C4H8N2OS and a molecular weight of 132.19 g/mol. Its IUPAC name is 1,3-oxazolidine-3-carbothioamide.
| Compound Name | 1,3-oxazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 57154446 |
| Molecular Formula | C4H8N2OS |
| Molecular Weight | 132.19 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | 1,3-oxazolidine-3-carbothioamide |
| SMILES | NC(=S)N1CCOC1 |
| InChI | InChI=1S/C4H8N2OS/c5-4(8)6-1-2-7-3-6/h1-3H2,(H2,5,8) |
| InChIKey | LLUVGLVHMJYWLU-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.19 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|