About methyl morpholine-4-carboximidothioate;morpholine-4-carbothioamide;oxolane
methyl morpholine-4-carboximidothioate;morpholine-4-carbothioamide;oxolane (PubChem CID 162002519) has the molecular formula C15H30N4O3S2
and a molecular weight of 378.56 g/mol. Its IUPAC name is methyl morpholine-4-carboximidothioate;morpholine-4-carbothioamide;oxolane.
Molecular Properties
| Compound Name | methyl morpholine-4-carboximidothioate;morpholine-4-carbothioamide;oxolane |
| PubChem CID | 162002519 |
| Molecular Formula | C15H30N4O3S2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | methyl morpholine-4-carboximidothioate;morpholine-4-carbothioamide;oxolane |
| SMILES | C1CCOC1.NC(=S)N1CCOCC1.[H]/N=C(\SC)N1CCOCC1 |
| InChI | InChI=1S/C6H12N2OS.C5H10N2OS.C4H8O/c1-10-6(7)8-2-4-9-5-3-8;6-5(9)7-1-3-8-4-2-7;1-2-4-5-3-1/h7H,2-5H2,1H3;1-4H2,(H2,6,9);1-4H2/b7-6-;; |
| InChIKey | YSKBLWSDIMOWMN-AQTVDGORSA-N |
| XLogP | 0.98 |
| TPSA | 84.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl morpholine-4-carboximidothioate;morpholine-4-carbothioamide;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl morpholine-4-carboximidothioate;morpholine-4-carbothioamide;oxolane?
The IUPAC name of methyl morpholine-4-carboximidothioate;morpholine-4-carbothioamide;oxolane (CID 162002519) is methyl morpholine-4-carboximidothioate;morpholine-4-carbothioamide;oxolane.
What is the SMILES notation for methyl morpholine-4-carboximidothioate;morpholine-4-carbothioamide;oxolane?
The canonical SMILES for methyl morpholine-4-carboximidothioate;morpholine-4-carbothioamide;oxolane is C1CCOC1.NC(=S)N1CCOCC1.[H]/N=C(\SC)N1CCOCC1.
What is the InChIKey of methyl morpholine-4-carboximidothioate;morpholine-4-carbothioamide;oxolane?
The InChIKey is YSKBLWSDIMOWMN-AQTVDGORSA-N. The full InChI is InChI=1S/C6H12N2OS.C5H10N2OS.C4H8O/c1-10-6(7)8-2-4-9-5-3-8;6-5(9)7-1-3-8-4-2-7;1-2-4-5-3-1/h7H,2-5H2,1H3;1-4H2,(H2,6,9);1-4H2/b7-6-;;.
What are the key properties of methyl morpholine-4-carboximidothioate;morpholine-4-carbothioamide;oxolane?
methyl morpholine-4-carboximidothioate;morpholine-4-carbothioamide;oxolane has a molecular weight of 378.56 g/mol, XLogP of 0.98, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl morpholine-4-carboximidothioate;morpholine-4-carbothioamide;oxolane is sourced from PubChem (CID 162002519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).