C11H18N2OS — CID 45118722
(2E)-3-amino-5-methyl-1-morpholin-4-ylhexa-2,4-diene-1-thione (PubChem CID 45118722) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is (2E)-3-amino-5-methyl-1-morpholin-4-ylhexa-2,4-diene-1-thione.
| Compound Name | (2E)-3-amino-5-methyl-1-morpholin-4-ylhexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 45118722 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | (2E)-3-amino-5-methyl-1-morpholin-4-ylhexa-2,4-diene-1-thione |
| SMILES | CC(C)=C/C(N)=C\C(=S)N1CCOCC1 |
| InChI | InChI=1S/C11H18N2OS/c1-9(2)7-10(12)8-11(15)13-3-5-14-6-4-13/h7-8H,3-6,12H2,1-2H3/b10-8+ |
| InChIKey | DOPCPOHNOOWVLC-CSKARUKUSA-N |
| XLogP | 1.45 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|