C9H16ClN3O — CID 143881894
(1E,3E)-1-chloro-2-methyl-4-morpholin-4-ylbuta-1,3-diene-1,4-diamine (PubChem CID 143881894) has the molecular formula C9H16ClN3O and a molecular weight of 217.70 g/mol. Its IUPAC name is (1E,3E)-1-chloro-2-methyl-4-morpholin-4-ylbuta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3E)-1-chloro-2-methyl-4-morpholin-4-ylbuta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 143881894 |
| Molecular Formula | C9H16ClN3O |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | (1E,3E)-1-chloro-2-methyl-4-morpholin-4-ylbuta-1,3-diene-1,4-diamine |
| SMILES | CC(/C=C(\N)N1CCOCC1)=C(/N)Cl |
| InChI | InChI=1S/C9H16ClN3O/c1-7(9(10)12)6-8(11)13-2-4-14-5-3-13/h6H,2-5,11-12H2,1H3/b8-6+,9-7- |
| InChIKey | BQFDHKHXJVXTRH-FFELTBSMSA-N |
| XLogP | 0.55 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|