C8H14ClN3O — CID 143112011
(1E,3E)-1-chloro-4-morpholin-4-ylbuta-1,3-diene-1,4-diamine (PubChem CID 143112011) has the molecular formula C8H14ClN3O and a molecular weight of 203.67 g/mol. Its IUPAC name is (1E,3E)-1-chloro-4-morpholin-4-ylbuta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3E)-1-chloro-4-morpholin-4-ylbuta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 143112011 |
| Molecular Formula | C8H14ClN3O |
| Molecular Weight | 203.67 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | (1E,3E)-1-chloro-4-morpholin-4-ylbuta-1,3-diene-1,4-diamine |
| SMILES | N/C(Cl)=C\C=C(/N)N1CCOCC1 |
| InChI | InChI=1S/C8H14ClN3O/c9-7(10)1-2-8(11)12-3-5-13-6-4-12/h1-2H,3-6,10-11H2/b7-1-,8-2+ |
| InChIKey | WEWXXLWXQXTZMS-JOTJMYPPSA-N |
| XLogP | 0.16 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.67 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|