C13H25NO5S2 — CID 11187568
1,4,7,10,13-pentaoxa-16-azacyclooctadecane-16-carbodithioic acid (PubChem CID 11187568) has the molecular formula C13H25NO5S2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 1,4,7,10,13-pentaoxa-16-azacyclooctadecane-16-carbodithioic acid.
| Compound Name | 1,4,7,10,13-pentaoxa-16-azacyclooctadecane-16-carbodithioic acid |
|---|---|
| PubChem CID | 11187568 |
| Molecular Formula | C13H25NO5S2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1,4,7,10,13-pentaoxa-16-azacyclooctadecane-16-carbodithioic acid |
| SMILES | S=C(S)N1CCOCCOCCOCCOCCOCC1 |
| InChI | InChI=1S/C13H25NO5S2/c20-13(21)14-1-3-15-5-7-17-9-11-19-12-10-18-8-6-16-4-2-14/h1-12H2,(H,20,21) |
| InChIKey | YZBMONLULSZKES-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 49.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|