C9H16NO3S2- — CID 58922118
1,4,7-trioxa-10-azacyclododecane-10-carbodithioate (PubChem CID 58922118) has the molecular formula C9H16NO3S2- and a molecular weight of 250.36 g/mol. Its IUPAC name is 1,4,7-trioxa-10-azacyclododecane-10-carbodithioate.
| Compound Name | 1,4,7-trioxa-10-azacyclododecane-10-carbodithioate |
|---|---|
| PubChem CID | 58922118 |
| Molecular Formula | C9H16NO3S2- |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 1,4,7-trioxa-10-azacyclododecane-10-carbodithioate |
| SMILES | S=C([S-])N1CCOCCOCCOCC1 |
| InChI | InChI=1S/C9H17NO3S2/c14-9(15)10-1-3-11-5-7-13-8-6-12-4-2-10/h1-8H2,(H,14,15)/p-1 |
| InChIKey | HQXMUCSDLFDWHS-UHFFFAOYSA-M |
| XLogP | 0.18 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|