C10H22N2OS2 — CID 22766674
1,3-oxazolidine-3-carbodithioate;triethylazanium (PubChem CID 22766674) has the molecular formula C10H22N2OS2 and a molecular weight of 250.43 g/mol. Its IUPAC name is 1,3-oxazolidine-3-carbodithioate;triethylazanium.
| Compound Name | 1,3-oxazolidine-3-carbodithioate;triethylazanium |
|---|---|
| PubChem CID | 22766674 |
| Molecular Formula | C10H22N2OS2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 1,3-oxazolidine-3-carbodithioate;triethylazanium |
| SMILES | CC[NH+](CC)CC.S=C([S-])N1CCOC1 |
| InChI | InChI=1S/C6H15N.C4H7NOS2/c1-4-7(5-2)6-3;7-4(8)5-1-2-6-3-5/h4-6H2,1-3H3;1-3H2,(H,7,8) |
| InChIKey | QVMBAZXLGVZGRR-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 16.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|