C7H11NO3 — CID 127006878
1-(1,3-oxazolidin-3-yl)butane-1,3-dione (PubChem CID 127006878) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is 1-(1,3-oxazolidin-3-yl)butane-1,3-dione.
| Compound Name | 1-(1,3-oxazolidin-3-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 127006878 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 1-(1,3-oxazolidin-3-yl)butane-1,3-dione |
| SMILES | CC(=O)CC(=O)N1CCOC1 |
| InChI | InChI=1S/C7H11NO3/c1-6(9)4-7(10)8-2-3-11-5-8/h2-5H2,1H3 |
| InChIKey | JMMNKEQKLJXDER-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|