C9H17ClN2O3 — CID 167204900
2-chloro-1-(1,6-dioxa-3,9-diazacycloundec-3-yl)ethanone (PubChem CID 167204900) has the molecular formula C9H17ClN2O3 and a molecular weight of 236.70 g/mol. Its IUPAC name is 2-chloro-1-(1,6-dioxa-3,9-diazacycloundec-3-yl)ethanone.
| Compound Name | 2-chloro-1-(1,6-dioxa-3,9-diazacycloundec-3-yl)ethanone |
|---|---|
| PubChem CID | 167204900 |
| Molecular Formula | C9H17ClN2O3 |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 2-chloro-1-(1,6-dioxa-3,9-diazacycloundec-3-yl)ethanone |
| SMILES | O=C(CCl)N1CCOCCNCCOC1 |
| InChI | InChI=1S/C9H17ClN2O3/c10-7-9(13)12-3-6-14-4-1-11-2-5-15-8-12/h11H,1-8H2 |
| InChIKey | SXMFKHHLFXINLL-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|