C8H13ClFNO2 — CID 167577834
2-chloro-1-(6-fluoro-6-methyl-1,4-oxazepan-4-yl)ethanone (PubChem CID 167577834) has the molecular formula C8H13ClFNO2 and a molecular weight of 209.65 g/mol. Its IUPAC name is 2-chloro-1-(6-fluoro-6-methyl-1,4-oxazepan-4-yl)ethanone.
| Compound Name | 2-chloro-1-(6-fluoro-6-methyl-1,4-oxazepan-4-yl)ethanone |
|---|---|
| PubChem CID | 167577834 |
| Molecular Formula | C8H13ClFNO2 |
| Molecular Weight | 209.65 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 2-chloro-1-(6-fluoro-6-methyl-1,4-oxazepan-4-yl)ethanone |
| SMILES | CC1(F)COCCN(C(=O)CCl)C1 |
| InChI | InChI=1S/C8H13ClFNO2/c1-8(10)5-11(7(12)4-9)2-3-13-6-8/h2-6H2,1H3 |
| InChIKey | YGVBSFNFUBTGIC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.65 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|