C11H20NNaO4S2 — CID 58922103
sodium 1,4,7,10-tetraoxa-13-azacyclopentadecane-13-carbodithioate (PubChem CID 58922103) has the molecular formula C11H20NNaO4S2 and a molecular weight of 317.41 g/mol. Its IUPAC name is sodium 1,4,7,10-tetraoxa-13-azacyclopentadecane-13-carbodithioate.
| Compound Name | sodium 1,4,7,10-tetraoxa-13-azacyclopentadecane-13-carbodithioate |
|---|---|
| PubChem CID | 58922103 |
| Molecular Formula | C11H20NNaO4S2 |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | sodium 1,4,7,10-tetraoxa-13-azacyclopentadecane-13-carbodithioate |
| SMILES | S=C([S-])N1CCOCCOCCOCCOCC1.[Na+] |
| InChI | InChI=1S/C11H21NO4S2.Na/c17-11(18)12-1-3-13-5-7-15-9-10-16-8-6-14-4-2-12;/h1-10H2,(H,17,18);/q;+1/p-1 |
| InChIKey | ABKBTKQEXGHRSP-UHFFFAOYSA-M |
| XLogP | -2.80 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|