C10H18O4Si — CID 134894264
methyl (2R)-2-ethyl-4-oxo-3-trimethylsilyloxetane-2-carboxylate (PubChem CID 134894264) has the molecular formula C10H18O4Si and a molecular weight of 230.34 g/mol. Its IUPAC name is methyl (2R)-2-ethyl-4-oxo-3-trimethylsilyloxetane-2-carboxylate.
| Compound Name | methyl (2R)-2-ethyl-4-oxo-3-trimethylsilyloxetane-2-carboxylate |
|---|---|
| PubChem CID | 134894264 |
| Molecular Formula | C10H18O4Si |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | methyl (2R)-2-ethyl-4-oxo-3-trimethylsilyloxetane-2-carboxylate |
| SMILES | CC[C@]1(C(=O)OC)OC(=O)C1[Si](C)(C)C |
| InChI | InChI=1S/C10H18O4Si/c1-6-10(9(12)13-2)7(8(11)14-10)15(3,4)5/h7H,6H2,1-5H3/t7?,10-/m0/s1 |
| InChIKey | IZHUGMLTZBVHMD-MHPPCMCBSA-N |
| XLogP | 1.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|