C11H20N2 — CID 134894729
(E)-[(1S,4R,5S,6R)-3,3,5,6-tetramethyl-2-bicyclo[2.2.1]heptanylidene]hydrazine (PubChem CID 134894729) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is (E)-[(1S,4R,5S,6R)-3,3,5,6-tetramethyl-2-bicyclo[2.2.1]heptanylidene]hydrazine.
| Compound Name | (E)-[(1S,4R,5S,6R)-3,3,5,6-tetramethyl-2-bicyclo[2.2.1]heptanylidene]hydrazine |
|---|---|
| PubChem CID | 134894729 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (E)-[(1S,4R,5S,6R)-3,3,5,6-tetramethyl-2-bicyclo[2.2.1]heptanylidene]hydrazine |
| SMILES | C[C@@H]1[C@H](C)[C@H]2C[C@@H]1/C(=N\N)C2(C)C |
| InChI | InChI=1S/C11H20N2/c1-6-7(2)9-5-8(6)10(13-12)11(9,3)4/h6-9H,5,12H2,1-4H3/b13-10+/t6-,7+,8+,9-/m1/s1 |
| InChIKey | RMZFLEIHVOEMFO-VMDDLEMGSA-N |
| XLogP | 2.25 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|