C9H11ClNO2P — CID 134895441
(4S,5S)-2-chloro-4-methyl-5-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide (PubChem CID 134895441) has the molecular formula C9H11ClNO2P and a molecular weight of 231.62 g/mol. Its IUPAC name is (4S,5S)-2-chloro-4-methyl-5-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide.
| Compound Name | (4S,5S)-2-chloro-4-methyl-5-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 134895441 |
| Molecular Formula | C9H11ClNO2P |
| Molecular Weight | 231.62 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | (4S,5S)-2-chloro-4-methyl-5-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
| SMILES | C[C@@H]1NP(=O)(Cl)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C9H11ClNO2P/c1-7-9(13-14(10,12)11-7)8-5-3-2-4-6-8/h2-7,9H,1H3,(H,11,12)/t7-,9+,14?/m0/s1 |
| InChIKey | MWSBRWZKJOTDBO-ADKJUTMJSA-N |
| XLogP | 3.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.62 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|