C13H20BNO — CID 608698
2-butyl-4-methyl-5-phenyl-1,3,2-oxazaborolidine (PubChem CID 608698) has the molecular formula C13H20BNO and a molecular weight of 217.12 g/mol. Its IUPAC name is 2-butyl-4-methyl-5-phenyl-1,3,2-oxazaborolidine.
| Compound Name | 2-butyl-4-methyl-5-phenyl-1,3,2-oxazaborolidine |
|---|---|
| PubChem CID | 608698 |
| Molecular Formula | C13H20BNO |
| Molecular Weight | 217.12 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 2-butyl-4-methyl-5-phenyl-1,3,2-oxazaborolidine |
| SMILES | CCCCB1NC(C)C(c2ccccc2)O1 |
| InChI | InChI=1S/C13H20BNO/c1-3-4-10-14-15-11(2)13(16-14)12-8-6-5-7-9-12/h5-9,11,13,15H,3-4,10H2,1-2H3 |
| InChIKey | LXWVPXKWXLRFRF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.12 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|