C11H14O — CID 134895810
(1R,2S,6R,7S)-5-methoxytricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 134895810) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is (1R,2S,6R,7S)-5-methoxytricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | (1R,2S,6R,7S)-5-methoxytricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 134895810 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (1R,2S,6R,7S)-5-methoxytricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | COC1C=C[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C11H14O/c1-12-10-5-4-9-7-2-3-8(6-7)11(9)10/h2-5,7-11H,6H2,1H3/t7-,8+,9-,10?,11+/m0/s1 |
| InChIKey | JMPFTFCSXAJLRW-SQVYSQSISA-N |
| XLogP | 2.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|