C8H16O2S3 — CID 134895895
5-methylsulfonyl-2-propan-2-yl-1,3-dithiane (PubChem CID 134895895) has the molecular formula C8H16O2S3 and a molecular weight of 240.41 g/mol. Its IUPAC name is 5-methylsulfonyl-2-propan-2-yl-1,3-dithiane.
| Compound Name | 5-methylsulfonyl-2-propan-2-yl-1,3-dithiane |
|---|---|
| PubChem CID | 134895895 |
| Molecular Formula | C8H16O2S3 |
| Molecular Weight | 240.41 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 5-methylsulfonyl-2-propan-2-yl-1,3-dithiane |
| SMILES | CC(C)C1SCC(S(C)(=O)=O)CS1 |
| InChI | InChI=1S/C8H16O2S3/c1-6(2)8-11-4-7(5-12-8)13(3,9)10/h6-8H,4-5H2,1-3H3 |
| InChIKey | JSHUGCLEFKQTKU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |