C8H16OS2 — CID 12015131
(1S,2S)-2-tert-butyl-1,3-dithiane 1-oxide (PubChem CID 12015131) has the molecular formula C8H16OS2 and a molecular weight of 192.35 g/mol. Its IUPAC name is (1S,2S)-2-tert-butyl-1,3-dithiane 1-oxide.
| Compound Name | (1S,2S)-2-tert-butyl-1,3-dithiane 1-oxide |
|---|---|
| PubChem CID | 12015131 |
| Molecular Formula | C8H16OS2 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (1S,2S)-2-tert-butyl-1,3-dithiane 1-oxide |
| SMILES | CC(C)(C)[C@H]1SCCC[S@@]1=O |
| InChI | InChI=1S/C8H16OS2/c1-8(2,3)7-10-5-4-6-11(7)9/h7H,4-6H2,1-3H3/t7-,11-/m0/s1 |
| InChIKey | JATUOSMFWONTEG-CPCISQLKSA-N |
| XLogP | 2.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |