C41H50O — CID 134896070
(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-propan-2-yl-3-trityloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 134896070) has the molecular formula C41H50O and a molecular weight of 558.85 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-propan-2-yl-3-trityloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-propan-2-yl-3-trityloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 134896070 |
| Molecular Formula | C41H50O |
| Molecular Weight | 558.85 g/mol |
| Exact Mass | 558.39 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-propan-2-yl-3-trityloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC(C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(c5ccccc5)(c5ccccc5)c5ccccc5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C41H50O/c1-29(2)36-22-23-37-35-21-20-33-28-34(24-26-39(33,3)38(35)25-27-40(36,37)4)42-41(30-14-8-5-9-15-30,31-16-10-6-11-17-31)32-18-12-7-13-19-32/h5-20,29,34-38H,21-28H2,1-4H3/t34-,35-,36+,37-,38-,39-,40+/m0/s1 |
| InChIKey | MLYUOCBTDPUNNB-CUDLUXCVSA-N |
| XLogP | 10.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.85 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|