C14H27IO2Si — CID 134896207
(3R,4E,6E)-1-[tert-butyl(dimethyl)silyl]oxy-7-iodo-6-methylhepta-4,6-dien-3-ol (PubChem CID 134896207) has the molecular formula C14H27IO2Si and a molecular weight of 382.36 g/mol. Its IUPAC name is (3R,4E,6E)-1-[tert-butyl(dimethyl)silyl]oxy-7-iodo-6-methylhepta-4,6-dien-3-ol.
| Compound Name | (3R,4E,6E)-1-[tert-butyl(dimethyl)silyl]oxy-7-iodo-6-methylhepta-4,6-dien-3-ol |
|---|---|
| PubChem CID | 134896207 |
| Molecular Formula | C14H27IO2Si |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | (3R,4E,6E)-1-[tert-butyl(dimethyl)silyl]oxy-7-iodo-6-methylhepta-4,6-dien-3-ol |
| SMILES | CC(/C=C/[C@H](O)CCO[Si](C)(C)C(C)(C)C)=C\I |
| InChI | InChI=1S/C14H27IO2Si/c1-12(11-15)7-8-13(16)9-10-17-18(5,6)14(2,3)4/h7-8,11,13,16H,9-10H2,1-6H3/b8-7+,12-11+/t13-/m0/s1 |
| InChIKey | SVMNQHHSXFFPGX-CULXKKOZSA-N |
| XLogP | 4.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|