C15H30O2S — CID 134896567
(2R,3R)-2-tert-butylsulfinyl-3-ethenylnonan-1-ol (PubChem CID 134896567) has the molecular formula C15H30O2S and a molecular weight of 274.47 g/mol. Its IUPAC name is (2R,3R)-2-tert-butylsulfinyl-3-ethenylnonan-1-ol.
| Compound Name | (2R,3R)-2-tert-butylsulfinyl-3-ethenylnonan-1-ol |
|---|---|
| PubChem CID | 134896567 |
| Molecular Formula | C15H30O2S |
| Molecular Weight | 274.47 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | (2R,3R)-2-tert-butylsulfinyl-3-ethenylnonan-1-ol |
| SMILES | C=C[C@@H](CCCCCC)[C@H](CO)S(=O)C(C)(C)C |
| InChI | InChI=1S/C15H30O2S/c1-6-8-9-10-11-13(7-2)14(12-16)18(17)15(3,4)5/h7,13-14,16H,2,6,8-12H2,1,3-5H3/t13-,14-,18?/m0/s1 |
| InChIKey | HJDQTPRWCFAMIE-QPKCZYJBSA-N |
| XLogP | 3.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|