C11H21O3S- — CID 162456050
(4S,5S,7R)-9-hydroxy-4,7-dimethylnon-1-ene-5-sulfinate (PubChem CID 162456050) has the molecular formula C11H21O3S- and a molecular weight of 233.35 g/mol. Its IUPAC name is (4S,5S,7R)-9-hydroxy-4,7-dimethylnon-1-ene-5-sulfinate.
| Compound Name | (4S,5S,7R)-9-hydroxy-4,7-dimethylnon-1-ene-5-sulfinate |
|---|---|
| PubChem CID | 162456050 |
| Molecular Formula | C11H21O3S- |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (4S,5S,7R)-9-hydroxy-4,7-dimethylnon-1-ene-5-sulfinate |
| SMILES | C=CC[C@H](C)[C@H](C[C@H](C)CCO)S(=O)[O-] |
| InChI | InChI=1S/C11H22O3S/c1-4-5-10(3)11(15(13)14)8-9(2)6-7-12/h4,9-12H,1,5-8H2,2-3H3,(H,13,14)/p-1/t9-,10+,11+/m1/s1 |
| InChIKey | QQYVLIZWEXZNQN-VWYCJHECSA-M |
| XLogP | 1.85 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|