C10H18OS — CID 143882626
3-hexyl-2,3-dihydrothiophen-2-ol (PubChem CID 143882626) has the molecular formula C10H18OS and a molecular weight of 186.32 g/mol. Its IUPAC name is 3-hexyl-2,3-dihydrothiophen-2-ol.
| Compound Name | 3-hexyl-2,3-dihydrothiophen-2-ol |
|---|---|
| PubChem CID | 143882626 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | 3-hexyl-2,3-dihydrothiophen-2-ol |
| SMILES | CCCCCCC1C=CSC1O |
| InChI | InChI=1S/C10H18OS/c1-2-3-4-5-6-9-7-8-12-10(9)11/h7-11H,2-6H2,1H3 |
| InChIKey | KFZICOCFOLEZGC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|