About phenyl(phenyl)methanol;ruthenium(1+);tetrakis(trimethylphosphane)
phenyl(phenyl)methanol;ruthenium(1+);tetrakis(trimethylphosphane) (PubChem CID 134898725) has the molecular formula C25H47OP4Ru
and a molecular weight of 588.62 g/mol. Its IUPAC name is phenyl(phenyl)methanol;ruthenium(1+);tetrakis(trimethylphosphane).
Molecular Properties
| Compound Name | phenyl(phenyl)methanol;ruthenium(1+);tetrakis(trimethylphosphane) |
| PubChem CID | 134898725 |
| Molecular Formula | C25H47OP4Ru |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | phenyl(phenyl)methanol;ruthenium(1+);tetrakis(trimethylphosphane) |
| SMILES | CP(C)C.CP(C)C.CP(C)C.CP(C)C.OC(c1[c-]cccc1)c1ccccc1.[Ru+] |
| InChI | InChI=1S/C13H11O.4C3H9P.Ru/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;4*1-4(2)3;/h1-9,13-14H;4*1-3H3;/q-1;;;;;+1 |
| InChIKey | BRTDDIBKMNPBLB-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phenyl(phenyl)methanol;ruthenium(1+);tetrakis(trimethylphosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl(phenyl)methanol;ruthenium(1+);tetrakis(trimethylphosphane)?
The IUPAC name of phenyl(phenyl)methanol;ruthenium(1+);tetrakis(trimethylphosphane) (CID 134898725) is phenyl(phenyl)methanol;ruthenium(1+);tetrakis(trimethylphosphane).
What is the SMILES notation for phenyl(phenyl)methanol;ruthenium(1+);tetrakis(trimethylphosphane)?
The canonical SMILES for phenyl(phenyl)methanol;ruthenium(1+);tetrakis(trimethylphosphane) is CP(C)C.CP(C)C.CP(C)C.CP(C)C.OC(c1[c-]cccc1)c1ccccc1.[Ru+].
What is the InChIKey of phenyl(phenyl)methanol;ruthenium(1+);tetrakis(trimethylphosphane)?
The InChIKey is BRTDDIBKMNPBLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11O.4C3H9P.Ru/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;4*1-4(2)3;/h1-9,13-14H;4*1-3H3;/q-1;;;;;+1.
What are the key properties of phenyl(phenyl)methanol;ruthenium(1+);tetrakis(trimethylphosphane)?
phenyl(phenyl)methanol;ruthenium(1+);tetrakis(trimethylphosphane) has a molecular weight of 588.62 g/mol, XLogP of 8.00, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl(phenyl)methanol;ruthenium(1+);tetrakis(trimethylphosphane) is sourced from PubChem (CID 134898725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).