C13H12O4 — CID 134900510
(3aR,6S,6aR)-6-benzyl-3,3a,6,6a-tetrahydrofuro[3,2-b]furan-2,5-dione (PubChem CID 134900510) has the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. Its IUPAC name is (3aR,6S,6aR)-6-benzyl-3,3a,6,6a-tetrahydrofuro[3,2-b]furan-2,5-dione.
| Compound Name | (3aR,6S,6aR)-6-benzyl-3,3a,6,6a-tetrahydrofuro[3,2-b]furan-2,5-dione |
|---|---|
| PubChem CID | 134900510 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (3aR,6S,6aR)-6-benzyl-3,3a,6,6a-tetrahydrofuro[3,2-b]furan-2,5-dione |
| SMILES | O=C1C[C@H]2OC(=O)[C@@H](Cc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C13H12O4/c14-11-7-10-12(17-11)9(13(15)16-10)6-8-4-2-1-3-5-8/h1-5,9-10,12H,6-7H2/t9-,10+,12+/m0/s1 |
| InChIKey | PJMLFRKUUDXDHE-HOSYDEDBSA-N |
| XLogP | 1.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |