C24H36O3 — CID 10248725
(3aR,5S,6aR)-5,6a-dimethyl-5-(10-phenyldecyl)-3a,6-dihydro-3H-furo[3,2-b]furan-2-one (PubChem CID 10248725) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is (3aR,5S,6aR)-5,6a-dimethyl-5-(10-phenyldecyl)-3a,6-dihydro-3H-furo[3,2-b]furan-2-one.
| Compound Name | (3aR,5S,6aR)-5,6a-dimethyl-5-(10-phenyldecyl)-3a,6-dihydro-3H-furo[3,2-b]furan-2-one |
|---|---|
| PubChem CID | 10248725 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (3aR,5S,6aR)-5,6a-dimethyl-5-(10-phenyldecyl)-3a,6-dihydro-3H-furo[3,2-b]furan-2-one |
| SMILES | C[C@]1(CCCCCCCCCCc2ccccc2)C[C@@]2(C)OC(=O)C[C@H]2O1 |
| InChI | InChI=1S/C24H36O3/c1-23(19-24(2)21(26-23)18-22(25)27-24)17-13-8-6-4-3-5-7-10-14-20-15-11-9-12-16-20/h9,11-12,15-16,21H,3-8,10,13-14,17-19H2,1-2H3/t21-,23+,24-/m1/s1 |
| InChIKey | PGZGTNDHESKDJB-YFNKSVMNSA-N |
| XLogP | 5.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|