C24H38O4 — CID 71619110
(4R,5R)-4-hydroxy-5-[(2S)-2-hydroxy-2-methyl-12-phenyldodecyl]-5-methyloxolan-2-one (PubChem CID 71619110) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is (4R,5R)-4-hydroxy-5-[(2S)-2-hydroxy-2-methyl-12-phenyldodecyl]-5-methyloxolan-2-one.
| Compound Name | (4R,5R)-4-hydroxy-5-[(2S)-2-hydroxy-2-methyl-12-phenyldodecyl]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 71619110 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | (4R,5R)-4-hydroxy-5-[(2S)-2-hydroxy-2-methyl-12-phenyldodecyl]-5-methyloxolan-2-one |
| SMILES | C[C@](O)(CCCCCCCCCCc1ccccc1)C[C@@]1(C)OC(=O)C[C@H]1O |
| InChI | InChI=1S/C24H38O4/c1-23(27,19-24(2)21(25)18-22(26)28-24)17-13-8-6-4-3-5-7-10-14-20-15-11-9-12-16-20/h9,11-12,15-16,21,25,27H,3-8,10,13-14,17-19H2,1-2H3/t21-,23+,24-/m1/s1 |
| InChIKey | GFBQUZIAOMGAPQ-YFNKSVMNSA-N |
| XLogP | 4.95 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|