C18H20O5 — CID 134900638
dimethyl 3-acetyl-4-methylidene-2-phenylcyclopentane-1,1-dicarboxylate (PubChem CID 134900638) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is dimethyl 3-acetyl-4-methylidene-2-phenylcyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl 3-acetyl-4-methylidene-2-phenylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 134900638 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | dimethyl 3-acetyl-4-methylidene-2-phenylcyclopentane-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OC)(C(=O)OC)C(c2ccccc2)C1C(C)=O |
| InChI | InChI=1S/C18H20O5/c1-11-10-18(16(20)22-3,17(21)23-4)15(14(11)12(2)19)13-8-6-5-7-9-13/h5-9,14-15H,1,10H2,2-4H3 |
| InChIKey | WEXFLHWLVIJZLV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|