C16H21NO3 — CID 134900684
methyl 2-[(2S)-1-[(1R)-2-hydroxy-1-phenylethyl]pyrrolidin-2-yl]prop-2-enoate (PubChem CID 134900684) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is methyl 2-[(2S)-1-[(1R)-2-hydroxy-1-phenylethyl]pyrrolidin-2-yl]prop-2-enoate.
| Compound Name | methyl 2-[(2S)-1-[(1R)-2-hydroxy-1-phenylethyl]pyrrolidin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 134900684 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | methyl 2-[(2S)-1-[(1R)-2-hydroxy-1-phenylethyl]pyrrolidin-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CCCN1[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C16H21NO3/c1-12(16(19)20-2)14-9-6-10-17(14)15(11-18)13-7-4-3-5-8-13/h3-5,7-8,14-15,18H,1,6,9-11H2,2H3/t14-,15-/m0/s1 |
| InChIKey | YYMJGCMTMLOTLD-GJZGRUSLSA-N |
| XLogP | 1.91 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|