C33H41NO3Si — CID 134901002
[(Z)-6-trimethylsilylhex-4-enyl] N-(1-trityloxybut-3-en-2-yl)carbamate (PubChem CID 134901002) has the molecular formula C33H41NO3Si and a molecular weight of 527.78 g/mol. Its IUPAC name is [(Z)-6-trimethylsilylhex-4-enyl] N-(1-trityloxybut-3-en-2-yl)carbamate.
| Compound Name | [(Z)-6-trimethylsilylhex-4-enyl] N-(1-trityloxybut-3-en-2-yl)carbamate |
|---|---|
| PubChem CID | 134901002 |
| Molecular Formula | C33H41NO3Si |
| Molecular Weight | 527.78 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | [(Z)-6-trimethylsilylhex-4-enyl] N-(1-trityloxybut-3-en-2-yl)carbamate |
| SMILES | C=CC(COC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OCCC/C=C\C[Si](C)(C)C |
| InChI | InChI=1S/C33H41NO3Si/c1-5-31(34-32(35)36-25-17-6-7-18-26-38(2,3)4)27-37-33(28-19-11-8-12-20-28,29-21-13-9-14-22-29)30-23-15-10-16-24-30/h5,7-16,18-24,31H,1,6,17,25-27H2,2-4H3,(H,34,35)/b18-7- |
| InChIKey | WHJOGNTZLDMTNI-WSVATBPTSA-N |
| XLogP | 7.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.78 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|