C34H45NO5Si — CID 71817268
tert-butyl N-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-oxo-1-trityloxybutan-2-yl]carbamate (PubChem CID 71817268) has the molecular formula C34H45NO5Si and a molecular weight of 575.82 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-oxo-1-trityloxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-oxo-1-trityloxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 71817268 |
| Molecular Formula | C34H45NO5Si |
| Molecular Weight | 575.82 g/mol |
| Exact Mass | 575.31 |
| IUPAC Name | tert-butyl N-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-oxo-1-trityloxybutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H](C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H45NO5Si/c1-32(2,3)39-31(37)35-29(30(24-36)40-41(7,8)33(4,5)6)25-38-34(26-18-12-9-13-19-26,27-20-14-10-15-21-27)28-22-16-11-17-23-28/h9-24,29-30H,25H2,1-8H3,(H,35,37)/t29-,30+/m0/s1 |
| InChIKey | RZVAIRDQZVNUGU-XZWHSSHBSA-N |
| XLogP | 7.48 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.82 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|