C24H43NO5Si2 — CID 134852254
benzyl N-[(2S,3R)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxobutan-2-yl]carbamate (PubChem CID 134852254) has the molecular formula C24H43NO5Si2 and a molecular weight of 481.78 g/mol. Its IUPAC name is benzyl N-[(2S,3R)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S,3R)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 134852254 |
| Molecular Formula | C24H43NO5Si2 |
| Molecular Weight | 481.78 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | benzyl N-[(2S,3R)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](NC(=O)OCc1ccccc1)[C@H](C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H43NO5Si2/c1-23(2,3)31(7,8)29-18-20(21(16-26)30-32(9,10)24(4,5)6)25-22(27)28-17-19-14-12-11-13-15-19/h11-16,20-21H,17-18H2,1-10H3,(H,25,27)/t20-,21-/m0/s1 |
| InChIKey | ZCIROSVMOVDZLL-SFTDATJTSA-N |
| XLogP | 5.89 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.78 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|