C17H36O2Si — CID 134901008
2-methyl-1-[(2R,3S)-3-octyl-2-trimethylsilyloxiran-2-yl]propan-1-ol (PubChem CID 134901008) has the molecular formula C17H36O2Si and a molecular weight of 300.56 g/mol. Its IUPAC name is 2-methyl-1-[(2R,3S)-3-octyl-2-trimethylsilyloxiran-2-yl]propan-1-ol.
| Compound Name | 2-methyl-1-[(2R,3S)-3-octyl-2-trimethylsilyloxiran-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 134901008 |
| Molecular Formula | C17H36O2Si |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | 2-methyl-1-[(2R,3S)-3-octyl-2-trimethylsilyloxiran-2-yl]propan-1-ol |
| SMILES | CCCCCCCC[C@@H]1O[C@]1(C(O)C(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C17H36O2Si/c1-7-8-9-10-11-12-13-15-17(19-15,20(4,5)6)16(18)14(2)3/h14-16,18H,7-13H2,1-6H3/t15-,16?,17-/m0/s1 |
| InChIKey | BTEOWAAWLGXACX-QRFGZVGRSA-N |
| XLogP | 4.77 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|