C15H28OSi — CID 134901464
[(4aS,5R,8aS)-4a,5-dimethyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]oxy-trimethylsilane (PubChem CID 134901464) has the molecular formula C15H28OSi and a molecular weight of 252.47 g/mol. Its IUPAC name is [(4aS,5R,8aS)-4a,5-dimethyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]oxy-trimethylsilane.
| Compound Name | [(4aS,5R,8aS)-4a,5-dimethyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 134901464 |
| Molecular Formula | C15H28OSi |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | [(4aS,5R,8aS)-4a,5-dimethyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]oxy-trimethylsilane |
| SMILES | C[C@@H]1CCC[C@H]2CC(O[Si](C)(C)C)=CC[C@]21C |
| InChI | InChI=1S/C15H28OSi/c1-12-7-6-8-13-11-14(16-17(3,4)5)9-10-15(12,13)2/h9,12-13H,6-8,10-11H2,1-5H3/t12-,13+,15+/m1/s1 |
| InChIKey | WKQVOGHBWUGTCK-IPYPFGDCSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|