C17H26O6 — CID 134901928
diethyl 2-[(1S,2S,4R)-2-acetyloxy-2-bicyclo[2.2.1]heptanyl]butanedioate (PubChem CID 134901928) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is diethyl 2-[(1S,2S,4R)-2-acetyloxy-2-bicyclo[2.2.1]heptanyl]butanedioate.
| Compound Name | diethyl 2-[(1S,2S,4R)-2-acetyloxy-2-bicyclo[2.2.1]heptanyl]butanedioate |
|---|---|
| PubChem CID | 134901928 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | diethyl 2-[(1S,2S,4R)-2-acetyloxy-2-bicyclo[2.2.1]heptanyl]butanedioate |
| SMILES | CCOC(=O)CC(C(=O)OCC)[C@]1(OC(C)=O)C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C17H26O6/c1-4-21-15(19)9-14(16(20)22-5-2)17(23-11(3)18)10-12-6-7-13(17)8-12/h12-14H,4-10H2,1-3H3/t12-,13+,14?,17+/m1/s1 |
| InChIKey | FOTVVAGHXDHFBW-HMCVZBPISA-N |
| XLogP | 2.24 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|