C15H24O4 — CID 134902033
9-O-tert-butyl 1-O-ethyl (2E,4E)-nona-2,4-dienedioate (PubChem CID 134902033) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 9-O-tert-butyl 1-O-ethyl (2E,4E)-nona-2,4-dienedioate.
| Compound Name | 9-O-tert-butyl 1-O-ethyl (2E,4E)-nona-2,4-dienedioate |
|---|---|
| PubChem CID | 134902033 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 9-O-tert-butyl 1-O-ethyl (2E,4E)-nona-2,4-dienedioate |
| SMILES | CCOC(=O)/C=C/C=C/CCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H24O4/c1-5-18-13(16)11-9-7-6-8-10-12-14(17)19-15(2,3)4/h6-7,9,11H,5,8,10,12H2,1-4H3/b7-6+,11-9+ |
| InChIKey | KCSWBXZTGCMQNE-RXUIJTJXSA-N |
| XLogP | 3.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|