C14H24O2 — CID 134902758
1,2-bis(ethoxymethylidene)cyclooctane (PubChem CID 134902758) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 1,2-bis(ethoxymethylidene)cyclooctane.
| Compound Name | 1,2-bis(ethoxymethylidene)cyclooctane |
|---|---|
| PubChem CID | 134902758 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 1,2-bis(ethoxymethylidene)cyclooctane |
| SMILES | CCOC=C1CCCCCCC1=COCC |
| InChI | InChI=1S/C14H24O2/c1-3-15-11-13-9-7-5-6-8-10-14(13)12-16-4-2/h11-12H,3-10H2,1-2H3 |
| InChIKey | LWHQBRLGCJQOMX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|