C15H33BPb — CID 134903613
[(E)-4-diethylboranyl-2,2-dimethylhex-3-en-3-yl]-trimethylplumbane (PubChem CID 134903613) has the molecular formula C15H33BPb and a molecular weight of 431.44 g/mol. Its IUPAC name is [(E)-4-diethylboranyl-2,2-dimethylhex-3-en-3-yl]-trimethylplumbane.
| Compound Name | [(E)-4-diethylboranyl-2,2-dimethylhex-3-en-3-yl]-trimethylplumbane |
|---|---|
| PubChem CID | 134903613 |
| Molecular Formula | C15H33BPb |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | [(E)-4-diethylboranyl-2,2-dimethylhex-3-en-3-yl]-trimethylplumbane |
| SMILES | CCB(CC)/C(CC)=C(/C(C)(C)C)[Pb](C)(C)C |
| InChI | InChI=1S/C12H24B.3CH3.Pb/c1-7-11(10-12(4,5)6)13(8-2)9-3;;;;/h7-9H2,1-6H3;3*1H3; |
| InChIKey | NZOKJGOTGVJMCP-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|