C21H45BPb — CID 134904017
[(E)-4-di(propan-2-yl)boranyl-2,2,5-trimethylhex-3-en-3-yl]-triethylplumbane (PubChem CID 134904017) has the molecular formula C21H45BPb and a molecular weight of 515.60 g/mol. Its IUPAC name is [(E)-4-di(propan-2-yl)boranyl-2,2,5-trimethylhex-3-en-3-yl]-triethylplumbane.
| Compound Name | [(E)-4-di(propan-2-yl)boranyl-2,2,5-trimethylhex-3-en-3-yl]-triethylplumbane |
|---|---|
| PubChem CID | 134904017 |
| Molecular Formula | C21H45BPb |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 516.34 |
| IUPAC Name | [(E)-4-di(propan-2-yl)boranyl-2,2,5-trimethylhex-3-en-3-yl]-triethylplumbane |
| SMILES | CC[Pb](CC)(CC)/C(=C(\B(C(C)C)C(C)C)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H30B.3C2H5.Pb/c1-11(2)14(10-15(7,8)9)16(12(3)4)13(5)6;3*1-2;/h11-13H,1-9H3;3*1H2,2H3; |
| InChIKey | XBAHAXGHJASKMT-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|