C17H35B — CID 134978622
[(Z)-4,4-dimethylpent-2-en-3-yl]-bis(3-methylbutan-2-yl)borane (PubChem CID 134978622) has the molecular formula C17H35B and a molecular weight of 250.28 g/mol. Its IUPAC name is [(Z)-4,4-dimethylpent-2-en-3-yl]-bis(3-methylbutan-2-yl)borane.
| Compound Name | [(Z)-4,4-dimethylpent-2-en-3-yl]-bis(3-methylbutan-2-yl)borane |
|---|---|
| PubChem CID | 134978622 |
| Molecular Formula | C17H35B |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.28 |
| IUPAC Name | [(Z)-4,4-dimethylpent-2-en-3-yl]-bis(3-methylbutan-2-yl)borane |
| SMILES | C/C=C(/B(C(C)C(C)C)C(C)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H35B/c1-11-16(17(8,9)10)18(14(6)12(2)3)15(7)13(4)5/h11-15H,1-10H3/b16-11+ |
| InChIKey | GAAZFKDPNVNOKX-LFIBNONCSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|