C18H39BPb — CID 134903943
[(E)-4-di(propan-2-yl)boranyl-2,2,5-trimethylhex-3-en-3-yl]-trimethylplumbane (PubChem CID 134903943) has the molecular formula C18H39BPb and a molecular weight of 473.52 g/mol. Its IUPAC name is [(E)-4-di(propan-2-yl)boranyl-2,2,5-trimethylhex-3-en-3-yl]-trimethylplumbane.
| Compound Name | [(E)-4-di(propan-2-yl)boranyl-2,2,5-trimethylhex-3-en-3-yl]-trimethylplumbane |
|---|---|
| PubChem CID | 134903943 |
| Molecular Formula | C18H39BPb |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | [(E)-4-di(propan-2-yl)boranyl-2,2,5-trimethylhex-3-en-3-yl]-trimethylplumbane |
| SMILES | CC(C)B(/C(=C(/C(C)(C)C)[Pb](C)(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C15H30B.3CH3.Pb/c1-11(2)14(10-15(7,8)9)16(12(3)4)13(5)6;;;;/h11-13H,1-9H3;3*1H3; |
| InChIKey | FJVHTFRYCKRNBT-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|