C22H41B — CID 134903951
[(E)-2,3-dimethylnon-4-en-4-yl]-hex-1-ynyl-(3-methylbutan-2-yl)borane (PubChem CID 134903951) has the molecular formula C22H41B and a molecular weight of 316.38 g/mol. Its IUPAC name is [(E)-2,3-dimethylnon-4-en-4-yl]-hex-1-ynyl-(3-methylbutan-2-yl)borane.
| Compound Name | [(E)-2,3-dimethylnon-4-en-4-yl]-hex-1-ynyl-(3-methylbutan-2-yl)borane |
|---|---|
| PubChem CID | 134903951 |
| Molecular Formula | C22H41B |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.33 |
| IUPAC Name | [(E)-2,3-dimethylnon-4-en-4-yl]-hex-1-ynyl-(3-methylbutan-2-yl)borane |
| SMILES | CCCCC#CB(/C(=C\CCCC)C(C)C(C)C)C(C)C(C)C |
| InChI | InChI=1S/C22H41B/c1-9-11-13-15-17-23(21(8)19(5)6)22(16-14-12-10-2)20(7)18(3)4/h16,18-21H,9-14H2,1-8H3/b22-16- |
| InChIKey | RRIJIYIYBXMKBT-JWGURIENSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|